China (Mainland)
Premiumsupplier
128446-35-5 CAS NO.128446-35-5
- Min.Order: 100 Metric Ton
- Payment Terms: L/C,T/T,MoneyGram,Other
- Product Details
Keywords
- 128446-35-5
- 128446-35-5 seller in China
- 128446-35-5 factory in China
Quick Details
- ProName: 128446-35-5
- CasNo: 128446-35-5
- Molecular Formula: C63H112O42
- Appearance: white powder without visible impuritie...
- Application: Used for research and industrial manuf...
- DeliveryTime: Within7-10 days after receipt of your ...
- PackAge: As customer request
- Port: Qingdao,China
- ProductionCapacity: 100kg/Month Metric Ton/Day
- Purity: 98%min
- Storage: Store in a cool,dry place and keep awa...
- Transportation: Common products:Sea/Air/Courier Dange...
- LimitNum: 100 Metric Ton
Superiority
Details
Hydroxypropyl-beta-Cyclodextrin
Other name: HP-β -CD
1. Appearance: Hydroxypropyl-beta-Cyclodextrin is white powder, sweet, insipid innocent and can be used in both medicine field and food field.
2. Molecular formula: C42H70-XO35(CH2CHOH-CH3)X;
3. Molecular weght: 1135+58X;
4. CAS No.: 128446-35-5;
5. Spec: 99%;
6. Store: Cool and dry, avoid light, avoid high temperature place;
7. Packaging: 1kg/bag 10kg/barrel, or customized.
Application in different fields:
Pharmaceutical:
1. To increase the solubility of medicine and biological availability
2. To improve the bioavailability of drugs
3. To adjust or control the releasing of drugs.
4. To decrease the toxicities of drugs.
5. To improve the stabilities of drugs.
Cosmetic:
1. To suit for encapsulation of volatile compounds.
2. To increase shelf life of expensive flavours.
Food:
1. To prevent evaporation of volatile substances.
2. To get rid of the terrible smell.
3. To significantly enhance the effects of emulsification.
4. To make preservative of food release slowly.
